C20H12Cl2F3N3O2 — CID 30772806
2-N,6-N-bis(2-chlorophenyl)-4-(trifluoromethyl)pyridine-2,6-dicarboxamide (PubChem CID 30772806) has the molecular formula C20H12Cl2F3N3O2 and a molecular weight of 454.24 g/mol. Its IUPAC name is 2-N,6-N-bis(2-chlorophenyl)-4-(trifluoromethyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(2-chlorophenyl)-4-(trifluoromethyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 30772806 |
| Molecular Formula | C20H12Cl2F3N3O2 |
| Molecular Weight | 454.24 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | 2-N,6-N-bis(2-chlorophenyl)-4-(trifluoromethyl)pyridine-2,6-dicarboxamide |
| SMILES | O=C(Nc1ccccc1Cl)c1cc(C(F)(F)F)cc(C(=O)Nc2ccccc2Cl)n1 |
| InChI | InChI=1S/C20H12Cl2F3N3O2/c21-12-5-1-3-7-14(12)27-18(29)16-9-11(20(23,24)25)10-17(26-16)19(30)28-15-8-4-2-6-13(15)22/h1-10H,(H,27,29)(H,28,30) |
| InChIKey | ARZUZSLJZBRMAK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.24 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |