C21H17ClF3N3O — CID 71628646
2-chloro-N-[2-[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]phenyl]benzamide (PubChem CID 71628646) has the molecular formula C21H17ClF3N3O and a molecular weight of 419.83 g/mol. Its IUPAC name is 2-chloro-N-[2-[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[2-[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]phenyl]benzamide |
|---|---|
| PubChem CID | 71628646 |
| Molecular Formula | C21H17ClF3N3O |
| Molecular Weight | 419.83 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 2-chloro-N-[2-[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]phenyl]benzamide |
| SMILES | CN(C)c1cc(C(F)(F)F)cc(-c2ccccc2NC(=O)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C21H17ClF3N3O/c1-28(2)19-12-13(21(23,24)25)11-18(26-19)15-8-4-6-10-17(15)27-20(29)14-7-3-5-9-16(14)22/h3-12H,1-2H3,(H,27,29) |
| InChIKey | SFNPMZKHCHLBIO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.83 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |