C15H13ClF3N3O — CID 110299286
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(dimethylamino)pyridine-3-carboxamide (PubChem CID 110299286) has the molecular formula C15H13ClF3N3O and a molecular weight of 343.74 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(dimethylamino)pyridine-3-carboxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(dimethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110299286 |
| Molecular Formula | C15H13ClF3N3O |
| Molecular Weight | 343.74 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-(dimethylamino)pyridine-3-carboxamide |
| SMILES | CN(C)c1ncccc1C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C15H13ClF3N3O/c1-22(2)13-10(4-3-7-20-13)14(23)21-12-8-9(15(17,18)19)5-6-11(12)16/h3-8H,1-2H3,(H,21,23) |
| InChIKey | ZWMAAMPCOCVUJI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.74 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |