C20H16BrFN2S — CID 142085247
(E)-2-[4-(2-bromo-6-fluorophenyl)-1,3-thiazol-2-yl]but-2-enenitrile;toluene (PubChem CID 142085247) has the molecular formula C20H16BrFN2S and a molecular weight of 415.33 g/mol. Its IUPAC name is (E)-2-[4-(2-bromo-6-fluorophenyl)-1,3-thiazol-2-yl]but-2-enenitrile;toluene.
| Compound Name | (E)-2-[4-(2-bromo-6-fluorophenyl)-1,3-thiazol-2-yl]but-2-enenitrile;toluene |
|---|---|
| PubChem CID | 142085247 |
| Molecular Formula | C20H16BrFN2S |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | (E)-2-[4-(2-bromo-6-fluorophenyl)-1,3-thiazol-2-yl]but-2-enenitrile;toluene |
| SMILES | C/C=C(\C#N)c1nc(-c2c(F)cccc2Br)cs1.Cc1ccccc1 |
| InChI | InChI=1S/C13H8BrFN2S.C7H8/c1-2-8(6-16)13-17-11(7-18-13)12-9(14)4-3-5-10(12)15;1-7-5-3-2-4-6-7/h2-5,7H,1H3;2-6H,1H3/b8-2+; |
| InChIKey | CAIBIOULXNRODJ-VOKCZWNHSA-N |
| XLogP | 6.63 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|