C16H12ClN5OS3 — CID 137162741
2-(5-chloro-1,3-benzothiazol-2-yl)-4-[[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enenitrile (PubChem CID 137162741) has the molecular formula C16H12ClN5OS3 and a molecular weight of 421.96 g/mol. Its IUPAC name is 2-(5-chloro-1,3-benzothiazol-2-yl)-4-[[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enenitrile.
| Compound Name | 2-(5-chloro-1,3-benzothiazol-2-yl)-4-[[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
|---|---|
| PubChem CID | 137162741 |
| Molecular Formula | C16H12ClN5OS3 |
| Molecular Weight | 421.96 g/mol |
| Exact Mass | 420.99 |
| IUPAC Name | 2-(5-chloro-1,3-benzothiazol-2-yl)-4-[[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3-hydroxybut-2-enenitrile |
| SMILES | N#CC(=C(O)CSc1nnc(NC2CC2)s1)c1nc2cc(Cl)ccc2s1 |
| InChI | InChI=1S/C16H12ClN5OS3/c17-8-1-4-13-11(5-8)20-14(25-13)10(6-18)12(23)7-24-16-22-21-15(26-16)19-9-2-3-9/h1,4-5,9,23H,2-3,7H2,(H,19,21) |
| InChIKey | NIXCFVFDVUSRLZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.96 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|