C14H10N4OS4 — CID 135838315
(Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enenitrile (PubChem CID 135838315) has the molecular formula C14H10N4OS4 and a molecular weight of 378.53 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enenitrile |
|---|---|
| PubChem CID | 135838315 |
| Molecular Formula | C14H10N4OS4 |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-hydroxy-4-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enenitrile |
| SMILES | CSc1nnc(SC/C(O)=C(\C#N)c2nc3ccccc3s2)s1 |
| InChI | InChI=1S/C14H10N4OS4/c1-20-13-17-18-14(23-13)21-7-10(19)8(6-15)12-16-9-4-2-3-5-11(9)22-12/h2-5,19H,7H2,1H3/b10-8- |
| InChIKey | OKQDOOOKEHNBJK-NTMALXAHSA-N |
| XLogP | 4.45 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|