C9H13N3S2 — CID 25352768
N-cyclopropyl-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazol-2-amine (PubChem CID 25352768) has the molecular formula C9H13N3S2 and a molecular weight of 227.36 g/mol. Its IUPAC name is N-cyclopropyl-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-cyclopropyl-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 25352768 |
| Molecular Formula | C9H13N3S2 |
| Molecular Weight | 227.36 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | N-cyclopropyl-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazol-2-amine |
| SMILES | C=C(C)CSc1nnc(NC2CC2)s1 |
| InChI | InChI=1S/C9H13N3S2/c1-6(2)5-13-9-12-11-8(14-9)10-7-3-4-7/h7H,1,3-5H2,2H3,(H,10,11) |
| InChIKey | NKPKGYDVHOAIOD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|