C12H19N3S2 — CID 47096016
N-cyclohexyl-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazol-2-amine (PubChem CID 47096016) has the molecular formula C12H19N3S2 and a molecular weight of 269.44 g/mol. Its IUPAC name is N-cyclohexyl-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-cyclohexyl-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 47096016 |
| Molecular Formula | C12H19N3S2 |
| Molecular Weight | 269.44 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | N-cyclohexyl-5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazol-2-amine |
| SMILES | C=C(C)CSc1nnc(NC2CCCCC2)s1 |
| InChI | InChI=1S/C12H19N3S2/c1-9(2)8-16-12-15-14-11(17-12)13-10-6-4-3-5-7-10/h10H,1,3-8H2,2H3,(H,13,14) |
| InChIKey | ZWJPKMJHLIOXIY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|