C14H20N4O2S2 — CID 38656059
1-[2-[[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]pyrrolidine-2,5-dione (PubChem CID 38656059) has the molecular formula C14H20N4O2S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 1-[2-[[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 38656059 |
| Molecular Formula | C14H20N4O2S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-[2-[[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1CCSc1nnc(NC2CCCCC2)s1 |
| InChI | InChI=1S/C14H20N4O2S2/c19-11-6-7-12(20)18(11)8-9-21-14-17-16-13(22-14)15-10-4-2-1-3-5-10/h10H,1-9H2,(H,15,16) |
| InChIKey | VAJUSSZUTXNZLK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|