C26H21N5O2S2 — CID 135911522
(Z)-2-(1,3-benzothiazol-2-yl)-4-[[4-benzyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxypent-2-enenitrile (PubChem CID 135911522) has the molecular formula C26H21N5O2S2 and a molecular weight of 499.62 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-4-[[4-benzyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxypent-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-4-[[4-benzyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxypent-2-enenitrile |
|---|---|
| PubChem CID | 135911522 |
| Molecular Formula | C26H21N5O2S2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-4-[[4-benzyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxypent-2-enenitrile |
| SMILES | Cc1occc1-c1nnc(SC(C)/C(O)=C(\C#N)c2nc3ccccc3s2)n1Cc1ccccc1 |
| InChI | InChI=1S/C26H21N5O2S2/c1-16-19(12-13-33-16)24-29-30-26(31(24)15-18-8-4-3-5-9-18)34-17(2)23(32)20(14-27)25-28-21-10-6-7-11-22(21)35-25/h3-13,17,32H,15H2,1-2H3/b23-20- |
| InChIKey | ASDRJMIHUNRZHG-ATJXCDBQSA-N |
| XLogP | 6.48 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|