C19H20N4OS — CID 112785659
5-[[4-benzyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]pentanenitrile (PubChem CID 112785659) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is 5-[[4-benzyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]pentanenitrile.
| Compound Name | 5-[[4-benzyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]pentanenitrile |
|---|---|
| PubChem CID | 112785659 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 5-[[4-benzyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]pentanenitrile |
| SMILES | Cc1occc1-c1nnc(SCCCCC#N)n1Cc1ccccc1 |
| InChI | InChI=1S/C19H20N4OS/c1-15-17(10-12-24-15)18-21-22-19(25-13-7-3-6-11-20)23(18)14-16-8-4-2-5-9-16/h2,4-5,8-10,12H,3,6-7,13-14H2,1H3 |
| InChIKey | CDSYFAWUWKGPQD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 67.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|