C23H26N4S — CID 7169932
4-[[4-benzyl-5-(4-tert-butylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanenitrile (PubChem CID 7169932) has the molecular formula C23H26N4S and a molecular weight of 390.56 g/mol. Its IUPAC name is 4-[[4-benzyl-5-(4-tert-butylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanenitrile.
| Compound Name | 4-[[4-benzyl-5-(4-tert-butylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanenitrile |
|---|---|
| PubChem CID | 7169932 |
| Molecular Formula | C23H26N4S |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 4-[[4-benzyl-5-(4-tert-butylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanenitrile |
| SMILES | CC(C)(C)c1ccc(-c2nnc(SCCCC#N)n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H26N4S/c1-23(2,3)20-13-11-19(12-14-20)21-25-26-22(28-16-8-7-15-24)27(21)17-18-9-5-4-6-10-18/h4-6,9-14H,7-8,16-17H2,1-3H3 |
| InChIKey | LRRADMGEJVCPTN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|