C32H31N3S — CID 2432765
3-benzhydrylsulfanyl-4-benzyl-5-(4-tert-butylphenyl)-1,2,4-triazole (PubChem CID 2432765) has the molecular formula C32H31N3S and a molecular weight of 489.69 g/mol. Its IUPAC name is 3-benzhydrylsulfanyl-4-benzyl-5-(4-tert-butylphenyl)-1,2,4-triazole.
| Compound Name | 3-benzhydrylsulfanyl-4-benzyl-5-(4-tert-butylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 2432765 |
| Molecular Formula | C32H31N3S |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 3-benzhydrylsulfanyl-4-benzyl-5-(4-tert-butylphenyl)-1,2,4-triazole |
| SMILES | CC(C)(C)c1ccc(-c2nnc(SC(c3ccccc3)c3ccccc3)n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C32H31N3S/c1-32(2,3)28-21-19-27(20-22-28)30-33-34-31(35(30)23-24-13-7-4-8-14-24)36-29(25-15-9-5-10-16-25)26-17-11-6-12-18-26/h4-22,29H,23H2,1-3H3 |
| InChIKey | RHVYXLPJEGMFBF-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |