C16H14N4OS — CID 4800069
3-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile (PubChem CID 4800069) has the molecular formula C16H14N4OS and a molecular weight of 310.38 g/mol. Its IUPAC name is 3-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile.
| Compound Name | 3-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 4800069 |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 3-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile |
| SMILES | N#CCCSc1nnc(-c2ccco2)n1Cc1ccccc1 |
| InChI | InChI=1S/C16H14N4OS/c17-9-5-11-22-16-19-18-15(14-8-4-10-21-14)20(16)12-13-6-2-1-3-7-13/h1-4,6-8,10H,5,11-12H2 |
| InChIKey | AAKGSDULPCRHMB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 67.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|