C18H14Cl2N4S — CID 4856967
3-[[4-benzyl-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile (PubChem CID 4856967) has the molecular formula C18H14Cl2N4S and a molecular weight of 389.31 g/mol. Its IUPAC name is 3-[[4-benzyl-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile.
| Compound Name | 3-[[4-benzyl-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 4856967 |
| Molecular Formula | C18H14Cl2N4S |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 3-[[4-benzyl-5-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile |
| SMILES | N#CCCSc1nnc(-c2ccc(Cl)cc2Cl)n1Cc1ccccc1 |
| InChI | InChI=1S/C18H14Cl2N4S/c19-14-7-8-15(16(20)11-14)17-22-23-18(25-10-4-9-21)24(17)12-13-5-2-1-3-6-13/h1-3,5-8,11H,4,10,12H2 |
| InChIKey | YOQHBCMYEUYBMM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|