C17H20Cl2N4S — CID 112777157
5-[[5-(2,4-dichlorophenyl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]pentanenitrile (PubChem CID 112777157) has the molecular formula C17H20Cl2N4S and a molecular weight of 383.35 g/mol. Its IUPAC name is 5-[[5-(2,4-dichlorophenyl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]pentanenitrile.
| Compound Name | 5-[[5-(2,4-dichlorophenyl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]pentanenitrile |
|---|---|
| PubChem CID | 112777157 |
| Molecular Formula | C17H20Cl2N4S |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 5-[[5-(2,4-dichlorophenyl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]pentanenitrile |
| SMILES | CC(C)Cn1c(SCCCCC#N)nnc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H20Cl2N4S/c1-12(2)11-23-16(14-7-6-13(18)10-15(14)19)21-22-17(23)24-9-5-3-4-8-20/h6-7,10,12H,3-5,9,11H2,1-2H3 |
| InChIKey | RHXVIVGTBFFAPY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|