C21H21Cl2N5O3S — CID 16958612
2-[[5-(2,4-dichlorophenyl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-3-nitrophenyl)acetamide (PubChem CID 16958612) has the molecular formula C21H21Cl2N5O3S and a molecular weight of 494.40 g/mol. Its IUPAC name is 2-[[5-(2,4-dichlorophenyl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-[[5-(2,4-dichlorophenyl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 16958612 |
| Molecular Formula | C21H21Cl2N5O3S |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | 2-[[5-(2,4-dichlorophenyl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-methyl-3-nitrophenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nnc(-c3ccc(Cl)cc3Cl)n2CC(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H21Cl2N5O3S/c1-12(2)10-27-20(16-7-5-14(22)8-17(16)23)25-26-21(27)32-11-19(29)24-15-6-4-13(3)18(9-15)28(30)31/h4-9,12H,10-11H2,1-3H3,(H,24,29) |
| InChIKey | BOWVFJNRRUEBAM-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|