C22H23Cl2N5O2S — CID 24637297
N'-[2-[[5-(2,4-dichlorophenyl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-methylbenzohydrazide (PubChem CID 24637297) has the molecular formula C22H23Cl2N5O2S and a molecular weight of 492.43 g/mol. Its IUPAC name is N'-[2-[[5-(2,4-dichlorophenyl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-methylbenzohydrazide.
| Compound Name | N'-[2-[[5-(2,4-dichlorophenyl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-methylbenzohydrazide |
|---|---|
| PubChem CID | 24637297 |
| Molecular Formula | C22H23Cl2N5O2S |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | N'-[2-[[5-(2,4-dichlorophenyl)-4-(2-methylpropyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-methylbenzohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)CSc2nnc(-c3ccc(Cl)cc3Cl)n2CC(C)C)cc1 |
| InChI | InChI=1S/C22H23Cl2N5O2S/c1-13(2)11-29-20(17-9-8-16(23)10-18(17)24)26-28-22(29)32-12-19(30)25-27-21(31)15-6-4-14(3)5-7-15/h4-10,13H,11-12H2,1-3H3,(H,25,30)(H,27,31) |
| InChIKey | NAELVFMVAFESJL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|