C21H22N4S — CID 112778208
5-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentanenitrile (PubChem CID 112778208) has the molecular formula C21H22N4S and a molecular weight of 362.50 g/mol. Its IUPAC name is 5-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentanenitrile.
| Compound Name | 5-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentanenitrile |
|---|---|
| PubChem CID | 112778208 |
| Molecular Formula | C21H22N4S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 5-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentanenitrile |
| SMILES | Cc1ccc(-c2nnc(SCCCCC#N)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H22N4S/c1-16-6-10-18(11-7-16)20-23-24-21(26-15-5-3-4-14-22)25(20)19-12-8-17(2)9-13-19/h6-13H,3-5,15H2,1-2H3 |
| InChIKey | YNPKCFYPPLDBDG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|