C20H19Cl2N3O2S — CID 42741267
5-[[4-(3,4-dichlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentanoic acid (PubChem CID 42741267) has the molecular formula C20H19Cl2N3O2S and a molecular weight of 436.36 g/mol. Its IUPAC name is 5-[[4-(3,4-dichlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentanoic acid.
| Compound Name | 5-[[4-(3,4-dichlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentanoic acid |
|---|---|
| PubChem CID | 42741267 |
| Molecular Formula | C20H19Cl2N3O2S |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 5-[[4-(3,4-dichlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]pentanoic acid |
| SMILES | Cc1ccc(-c2nnc(SCCCCC(=O)O)n2-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H19Cl2N3O2S/c1-13-5-7-14(8-6-13)19-23-24-20(28-11-3-2-4-18(26)27)25(19)15-9-10-16(21)17(22)12-15/h5-10,12H,2-4,11H2,1H3,(H,26,27) |
| InChIKey | JSLGHVPCFYYANY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|