C27H30Cl2N4O3S — CID 42742607
ethyl 1-[5-[[4-(3,4-dichlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanoyl]piperidine-4-carboxylate (PubChem CID 42742607) has the molecular formula C27H30Cl2N4O3S and a molecular weight of 561.54 g/mol. Its IUPAC name is ethyl 1-[5-[[4-(3,4-dichlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-[[4-(3,4-dichlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42742607 |
| Molecular Formula | C27H30Cl2N4O3S |
| Molecular Weight | 561.54 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | ethyl 1-[5-[[4-(3,4-dichlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CCCCSc2nnc(-c3ccccc3)n2-c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C27H30Cl2N4O3S/c1-2-36-26(35)20-13-15-32(16-14-20)24(34)10-6-7-17-37-27-31-30-25(19-8-4-3-5-9-19)33(27)21-11-12-22(28)23(29)18-21/h3-5,8-9,11-12,18,20H,2,6-7,10,13-17H2,1H3 |
| InChIKey | LZYXROZLXRNONQ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.54 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|