C21H30N4O4S — CID 42731041
ethyl 1-[5-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]pentanoyl]piperidine-4-carboxylate (PubChem CID 42731041) has the molecular formula C21H30N4O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is ethyl 1-[5-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]pentanoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]pentanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42731041 |
| Molecular Formula | C21H30N4O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | ethyl 1-[5-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]pentanoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CCCCSc2nnc(-c3ccco3)n2CC)CC1 |
| InChI | InChI=1S/C21H30N4O4S/c1-3-25-19(17-8-7-14-29-17)22-23-21(25)30-15-6-5-9-18(26)24-12-10-16(11-13-24)20(27)28-4-2/h7-8,14,16H,3-6,9-13,15H2,1-2H3 |
| InChIKey | IKHNCAFGYDRPSH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 90.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|