C30H37N3O3S — CID 3322212
ethyl 1-[5-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylpentanoyl]piperidine-4-carboxylate (PubChem CID 3322212) has the molecular formula C30H37N3O3S and a molecular weight of 519.71 g/mol. Its IUPAC name is ethyl 1-[5-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylpentanoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylpentanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 3322212 |
| Molecular Formula | C30H37N3O3S |
| Molecular Weight | 519.71 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | ethyl 1-[5-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylpentanoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CCCCSc2nc(-c3ccccc3)c(-c3ccccc3)n2CC)CC1 |
| InChI | InChI=1S/C30H37N3O3S/c1-3-33-28(24-15-9-6-10-16-24)27(23-13-7-5-8-14-23)31-30(33)37-22-12-11-17-26(34)32-20-18-25(19-21-32)29(35)36-4-2/h5-10,13-16,25H,3-4,11-12,17-22H2,1-2H3 |
| InChIKey | FTMPBTYGTKYBPB-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.71 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|