C30H32ClN3OS — CID 5114065
2-chloro-N-[4-[1-ethyl-4,5-bis(4-methylphenyl)imidazol-2-yl]sulfanylbutyl]benzamide (PubChem CID 5114065) has the molecular formula C30H32ClN3OS and a molecular weight of 518.13 g/mol. Its IUPAC name is 2-chloro-N-[4-[1-ethyl-4,5-bis(4-methylphenyl)imidazol-2-yl]sulfanylbutyl]benzamide.
| Compound Name | 2-chloro-N-[4-[1-ethyl-4,5-bis(4-methylphenyl)imidazol-2-yl]sulfanylbutyl]benzamide |
|---|---|
| PubChem CID | 5114065 |
| Molecular Formula | C30H32ClN3OS |
| Molecular Weight | 518.13 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 2-chloro-N-[4-[1-ethyl-4,5-bis(4-methylphenyl)imidazol-2-yl]sulfanylbutyl]benzamide |
| SMILES | CCn1c(SCCCCNC(=O)c2ccccc2Cl)nc(-c2ccc(C)cc2)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C30H32ClN3OS/c1-4-34-28(24-17-13-22(3)14-18-24)27(23-15-11-21(2)12-16-23)33-30(34)36-20-8-7-19-32-29(35)25-9-5-6-10-26(25)31/h5-6,9-18H,4,7-8,19-20H2,1-3H3,(H,32,35) |
| InChIKey | UZBFQTIBIJARCX-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.13 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|