C28H27F3N4OS — CID 5137200
1-[3-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylpropyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 5137200) has the molecular formula C28H27F3N4OS and a molecular weight of 524.61 g/mol. Its IUPAC name is 1-[3-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylpropyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylpropyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 5137200 |
| Molecular Formula | C28H27F3N4OS |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | 1-[3-(1-ethyl-4,5-diphenylimidazol-2-yl)sulfanylpropyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | CCn1c(SCCCNC(=O)Nc2ccccc2C(F)(F)F)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C28H27F3N4OS/c1-2-35-25(21-14-7-4-8-15-21)24(20-12-5-3-6-13-20)34-27(35)37-19-11-18-32-26(36)33-23-17-10-9-16-22(23)28(29,30)31/h3-10,12-17H,2,11,18-19H2,1H3,(H2,32,33,36) |
| InChIKey | IXEDPRIGPUKXON-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|