C28H27F3N4O3S — CID 4559601
1-[3-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 4559601) has the molecular formula C28H27F3N4O3S and a molecular weight of 556.61 g/mol. Its IUPAC name is 1-[3-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 4559601 |
| Molecular Formula | C28H27F3N4O3S |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 1-[3-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | COc1ccc(-c2nc(SCCCNC(=O)Nc3ccccc3C(F)(F)F)[nH]c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H27F3N4O3S/c1-37-20-12-8-18(9-13-20)24-25(19-10-14-21(38-2)15-11-19)35-27(34-24)39-17-5-16-32-26(36)33-23-7-4-3-6-22(23)28(29,30)31/h3-4,6-15H,5,16-17H2,1-2H3,(H,34,35)(H2,32,33,36) |
| InChIKey | RKHYKJBKWQDEEO-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|