C33H40N4OS — CID 10482427
1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 10482427) has the molecular formula C33H40N4OS and a molecular weight of 540.78 g/mol. Its IUPAC name is 1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 10482427 |
| Molecular Formula | C33H40N4OS |
| Molecular Weight | 540.78 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | 1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NCCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C33H40N4OS/c1-23(2)27-19-14-20-28(24(3)4)31(27)35-32(38)34-21-12-7-13-22-39-33-36-29(25-15-8-5-9-16-25)30(37-33)26-17-10-6-11-18-26/h5-6,8-11,14-20,23-24H,7,12-13,21-22H2,1-4H3,(H,36,37)(H2,34,35,38) |
| InChIKey | XAXXJPBYTOJSPV-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.78 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|