C28H38N4OS — CID 142655134
[10-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-5-ethyldecyl]urea (PubChem CID 142655134) has the molecular formula C28H38N4OS and a molecular weight of 478.71 g/mol. Its IUPAC name is [10-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-5-ethyldecyl]urea.
| Compound Name | [10-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-5-ethyldecyl]urea |
|---|---|
| PubChem CID | 142655134 |
| Molecular Formula | C28H38N4OS |
| Molecular Weight | 478.71 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | [10-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-5-ethyldecyl]urea |
| SMILES | CCC(CCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)CCCCNC(N)=O |
| InChI | InChI=1S/C28H38N4OS/c1-2-22(15-11-12-20-30-27(29)33)14-6-5-13-21-34-28-31-25(23-16-7-3-8-17-23)26(32-28)24-18-9-4-10-19-24/h3-4,7-10,16-19,22H,2,5-6,11-15,20-21H2,1H3,(H,31,32)(H3,29,30,33) |
| InChIKey | BKULXDJTNWCGEO-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.71 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|