C30H35N3S — CID 10389955
5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-N-(4-phenylbutyl)pentan-1-amine (PubChem CID 10389955) has the molecular formula C30H35N3S and a molecular weight of 469.70 g/mol. Its IUPAC name is 5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-N-(4-phenylbutyl)pentan-1-amine.
| Compound Name | 5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-N-(4-phenylbutyl)pentan-1-amine |
|---|---|
| PubChem CID | 10389955 |
| Molecular Formula | C30H35N3S |
| Molecular Weight | 469.70 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-N-(4-phenylbutyl)pentan-1-amine |
| SMILES | c1ccc(CCCCNCCCCCSc2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C30H35N3S/c1-5-15-25(16-6-1)17-11-13-23-31-22-12-4-14-24-34-30-32-28(26-18-7-2-8-19-26)29(33-30)27-20-9-3-10-21-27/h1-3,5-10,15-16,18-21,31H,4,11-14,17,22-24H2,(H,32,33) |
| InChIKey | OBLYGHVSELPYGW-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.70 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|