C24H31N3S — CID 10408288
N-[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]ethyl]heptan-1-amine (PubChem CID 10408288) has the molecular formula C24H31N3S and a molecular weight of 393.60 g/mol. Its IUPAC name is N-[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]ethyl]heptan-1-amine.
| Compound Name | N-[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]ethyl]heptan-1-amine |
|---|---|
| PubChem CID | 10408288 |
| Molecular Formula | C24H31N3S |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-[2-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]ethyl]heptan-1-amine |
| SMILES | CCCCCCCNCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C24H31N3S/c1-2-3-4-5-12-17-25-18-19-28-24-26-22(20-13-8-6-9-14-20)23(27-24)21-15-10-7-11-16-21/h6-11,13-16,25H,2-5,12,17-19H2,1H3,(H,26,27) |
| InChIKey | YKWXDGISWYCMGV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|