C40H46N4OS — CID 10100542
1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-1-heptyl-3-(4-phenylphenyl)urea (PubChem CID 10100542) has the molecular formula C40H46N4OS and a molecular weight of 630.90 g/mol. Its IUPAC name is 1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-1-heptyl-3-(4-phenylphenyl)urea.
| Compound Name | 1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-1-heptyl-3-(4-phenylphenyl)urea |
|---|---|
| PubChem CID | 10100542 |
| Molecular Formula | C40H46N4OS |
| Molecular Weight | 630.90 g/mol |
| Exact Mass | 630.34 |
| IUPAC Name | 1-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]-1-heptyl-3-(4-phenylphenyl)urea |
| SMILES | CCCCCCCN(CCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)C(=O)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C40H46N4OS/c1-2-3-4-5-16-29-44(40(45)41-36-27-25-33(26-28-36)32-19-10-6-11-20-32)30-17-9-18-31-46-39-42-37(34-21-12-7-13-22-34)38(43-39)35-23-14-8-15-24-35/h6-8,10-15,19-28H,2-5,9,16-18,29-31H2,1H3,(H,41,45)(H,42,43) |
| InChIKey | GULNXCGIOOZKLR-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.90 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|