C28H37N3OS — CID 5099566
N-[3-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]propyl]decanamide (PubChem CID 5099566) has the molecular formula C28H37N3OS and a molecular weight of 463.69 g/mol. Its IUPAC name is N-[3-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]propyl]decanamide.
| Compound Name | N-[3-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]propyl]decanamide |
|---|---|
| PubChem CID | 5099566 |
| Molecular Formula | C28H37N3OS |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | N-[3-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]propyl]decanamide |
| SMILES | CCCCCCCCCC(=O)NCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C28H37N3OS/c1-2-3-4-5-6-7-14-20-25(32)29-21-15-22-33-28-30-26(23-16-10-8-11-17-23)27(31-28)24-18-12-9-13-19-24/h8-13,16-19H,2-7,14-15,20-22H2,1H3,(H,29,32)(H,30,31) |
| InChIKey | UDVIOGNILHLGCN-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|