C25H24N4OS — CID 54340292
4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-N-(4-methyl-2-pyridinyl)butanamide (PubChem CID 54340292) has the molecular formula C25H24N4OS and a molecular weight of 428.56 g/mol. Its IUPAC name is 4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-N-(4-methyl-2-pyridinyl)butanamide.
| Compound Name | 4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-N-(4-methyl-2-pyridinyl)butanamide |
|---|---|
| PubChem CID | 54340292 |
| Molecular Formula | C25H24N4OS |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-N-(4-methyl-2-pyridinyl)butanamide |
| SMILES | Cc1ccnc(NC(=O)CCCSc2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c1 |
| InChI | InChI=1S/C25H24N4OS/c1-18-14-15-26-21(17-18)27-22(30)13-8-16-31-25-28-23(19-9-4-2-5-10-19)24(29-25)20-11-6-3-7-12-20/h2-7,9-12,14-15,17H,8,13,16H2,1H3,(H,28,29)(H,26,27,30) |
| InChIKey | TYLGYZNAVVGBBE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|