C26H26N4OS — CID 54116135
N-(4,6-dimethyl-2-pyridinyl)-4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butanamide (PubChem CID 54116135) has the molecular formula C26H26N4OS and a molecular weight of 442.59 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyridinyl)-4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butanamide.
| Compound Name | N-(4,6-dimethyl-2-pyridinyl)-4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 54116135 |
| Molecular Formula | C26H26N4OS |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | N-(4,6-dimethyl-2-pyridinyl)-4-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]butanamide |
| SMILES | Cc1cc(C)nc(NC(=O)CCCSc2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c1 |
| InChI | InChI=1S/C26H26N4OS/c1-18-16-19(2)27-22(17-18)28-23(31)14-9-15-32-26-29-24(20-10-5-3-6-11-20)25(30-26)21-12-7-4-8-13-21/h3-8,10-13,16-17H,9,14-15H2,1-2H3,(H,29,30)(H,27,28,31) |
| InChIKey | NKMCWRGADQYRSA-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|