C27H26F2N4OS — CID 10345554
1-(2,4-difluorophenyl)-3-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]urea (PubChem CID 10345554) has the molecular formula C27H26F2N4OS and a molecular weight of 492.60 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]urea |
|---|---|
| PubChem CID | 10345554 |
| Molecular Formula | C27H26F2N4OS |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[5-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]pentyl]urea |
| SMILES | O=C(NCCCCCSc1nc(-c2ccccc2)c(-c2ccccc2)[nH]1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C27H26F2N4OS/c28-21-14-15-23(22(29)18-21)31-26(34)30-16-8-3-9-17-35-27-32-24(19-10-4-1-5-11-19)25(33-27)20-12-6-2-7-13-20/h1-2,4-7,10-15,18H,3,8-9,16-17H2,(H,32,33)(H2,30,31,34) |
| InChIKey | NBXPABCRKXOEDO-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|