C17H15F2N3OS — CID 22633522
4-(1H-benzimidazol-2-ylsulfanyl)-N-(2,4-difluorophenyl)butanamide (PubChem CID 22633522) has the molecular formula C17H15F2N3OS and a molecular weight of 347.39 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanyl)-N-(2,4-difluorophenyl)butanamide.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanyl)-N-(2,4-difluorophenyl)butanamide |
|---|---|
| PubChem CID | 22633522 |
| Molecular Formula | C17H15F2N3OS |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanyl)-N-(2,4-difluorophenyl)butanamide |
| SMILES | O=C(CCCSc1nc2ccccc2[nH]1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H15F2N3OS/c18-11-7-8-13(12(19)10-11)20-16(23)6-3-9-24-17-21-14-4-1-2-5-15(14)22-17/h1-2,4-5,7-8,10H,3,6,9H2,(H,20,23)(H,21,22) |
| InChIKey | LOQOXGHRSUCZSV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|