C18H18BrF2N3S — CID 90666189
2-(1H-benzimidazol-2-ylsulfanyl)-N-(2-bromoethyl)-N-[(2,4-difluorophenyl)methyl]ethanamine (PubChem CID 90666189) has the molecular formula C18H18BrF2N3S and a molecular weight of 426.33 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanyl)-N-(2-bromoethyl)-N-[(2,4-difluorophenyl)methyl]ethanamine.
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-(2-bromoethyl)-N-[(2,4-difluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 90666189 |
| Molecular Formula | C18H18BrF2N3S |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanyl)-N-(2-bromoethyl)-N-[(2,4-difluorophenyl)methyl]ethanamine |
| SMILES | Fc1ccc(CN(CCBr)CCSc2nc3ccccc3[nH]2)c(F)c1 |
| InChI | InChI=1S/C18H18BrF2N3S/c19-7-8-24(12-13-5-6-14(20)11-15(13)21)9-10-25-18-22-16-3-1-2-4-17(16)23-18/h1-6,11H,7-10,12H2,(H,22,23) |
| InChIKey | GBVIXRCEPCCMAT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|