C22H28N4OS2 — CID 22592209
9-(1H-benzimidazol-2-ylsulfanyl)-N-(2-methylsulfanyl-3-pyridinyl)nonanamide (PubChem CID 22592209) has the molecular formula C22H28N4OS2 and a molecular weight of 428.63 g/mol. Its IUPAC name is 9-(1H-benzimidazol-2-ylsulfanyl)-N-(2-methylsulfanyl-3-pyridinyl)nonanamide.
| Compound Name | 9-(1H-benzimidazol-2-ylsulfanyl)-N-(2-methylsulfanyl-3-pyridinyl)nonanamide |
|---|---|
| PubChem CID | 22592209 |
| Molecular Formula | C22H28N4OS2 |
| Molecular Weight | 428.63 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 9-(1H-benzimidazol-2-ylsulfanyl)-N-(2-methylsulfanyl-3-pyridinyl)nonanamide |
| SMILES | CSc1ncccc1NC(=O)CCCCCCCCSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H28N4OS2/c1-28-21-19(13-10-15-23-21)24-20(27)14-6-4-2-3-5-9-16-29-22-25-17-11-7-8-12-18(17)26-22/h7-8,10-13,15H,2-6,9,14,16H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | BQSVNIFZMBNPGJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|