C20H21BrN4O2S — CID 24982993
4-(1H-benzimidazol-2-ylsulfanyl)-N-[2-(2-bromoanilino)-2-oxoethyl]-N-methylbutanamide (PubChem CID 24982993) has the molecular formula C20H21BrN4O2S and a molecular weight of 461.39 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanyl)-N-[2-(2-bromoanilino)-2-oxoethyl]-N-methylbutanamide.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanyl)-N-[2-(2-bromoanilino)-2-oxoethyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 24982993 |
| Molecular Formula | C20H21BrN4O2S |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanyl)-N-[2-(2-bromoanilino)-2-oxoethyl]-N-methylbutanamide |
| SMILES | CN(CC(=O)Nc1ccccc1Br)C(=O)CCCSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H21BrN4O2S/c1-25(13-18(26)22-15-8-3-2-7-14(15)21)19(27)11-6-12-28-20-23-16-9-4-5-10-17(16)24-20/h2-5,7-10H,6,11-13H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | DJNANNYYVPNPBJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|