C23H21N3OS — CID 8001742
4-(1H-benzimidazol-2-ylsulfanyl)-N-(2-phenylphenyl)butanamide (PubChem CID 8001742) has the molecular formula C23H21N3OS and a molecular weight of 387.51 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanyl)-N-(2-phenylphenyl)butanamide.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanyl)-N-(2-phenylphenyl)butanamide |
|---|---|
| PubChem CID | 8001742 |
| Molecular Formula | C23H21N3OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanyl)-N-(2-phenylphenyl)butanamide |
| SMILES | O=C(CCCSc1nc2ccccc2[nH]1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C23H21N3OS/c27-22(15-8-16-28-23-25-20-13-6-7-14-21(20)26-23)24-19-12-5-4-11-18(19)17-9-2-1-3-10-17/h1-7,9-14H,8,15-16H2,(H,24,27)(H,25,26) |
| InChIKey | DUNLQXAOBGSVBF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|