C18H15FN4OS2 — CID 2102486
4-(1H-benzimidazol-2-ylsulfanyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)butanamide (PubChem CID 2102486) has the molecular formula C18H15FN4OS2 and a molecular weight of 386.48 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 2102486 |
| Molecular Formula | C18H15FN4OS2 |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)butanamide |
| SMILES | O=C(CCCSc1nc2ccccc2[nH]1)Nc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C18H15FN4OS2/c19-11-7-8-14-15(10-11)26-18(22-14)23-16(24)6-3-9-25-17-20-12-4-1-2-5-13(12)21-17/h1-2,4-5,7-8,10H,3,6,9H2,(H,20,21)(H,22,23,24) |
| InChIKey | ZBLFWHNWHRDSFN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|