C17H19F4N3O4S — CID 171354020
N-(6-fluoro-1,3-benzothiazol-2-yl)-7-[(3,3,3-trifluoro-2,2-dihydroxypropanoyl)amino]heptanamide (PubChem CID 171354020) has the molecular formula C17H19F4N3O4S and a molecular weight of 437.42 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-7-[(3,3,3-trifluoro-2,2-dihydroxypropanoyl)amino]heptanamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-7-[(3,3,3-trifluoro-2,2-dihydroxypropanoyl)amino]heptanamide |
|---|---|
| PubChem CID | 171354020 |
| Molecular Formula | C17H19F4N3O4S |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-7-[(3,3,3-trifluoro-2,2-dihydroxypropanoyl)amino]heptanamide |
| SMILES | O=C(CCCCCCNC(=O)C(O)(O)C(F)(F)F)Nc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C17H19F4N3O4S/c18-10-6-7-11-12(9-10)29-15(23-11)24-13(25)5-3-1-2-4-8-22-14(26)16(27,28)17(19,20)21/h6-7,9,27-28H,1-5,8H2,(H,22,26)(H,23,24,25) |
| InChIKey | IINAHAZMKOTGFT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|