C24H32N4OS3 — CID 22592096
5-(1H-benzimidazol-2-ylsulfanyl)-N-[6-methyl-2,4-bis(propan-2-ylsulfanyl)-3-pyridinyl]pentanamide (PubChem CID 22592096) has the molecular formula C24H32N4OS3 and a molecular weight of 488.75 g/mol. Its IUPAC name is 5-(1H-benzimidazol-2-ylsulfanyl)-N-[6-methyl-2,4-bis(propan-2-ylsulfanyl)-3-pyridinyl]pentanamide.
| Compound Name | 5-(1H-benzimidazol-2-ylsulfanyl)-N-[6-methyl-2,4-bis(propan-2-ylsulfanyl)-3-pyridinyl]pentanamide |
|---|---|
| PubChem CID | 22592096 |
| Molecular Formula | C24H32N4OS3 |
| Molecular Weight | 488.75 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 5-(1H-benzimidazol-2-ylsulfanyl)-N-[6-methyl-2,4-bis(propan-2-ylsulfanyl)-3-pyridinyl]pentanamide |
| SMILES | Cc1cc(SC(C)C)c(NC(=O)CCCCSc2nc3ccccc3[nH]2)c(SC(C)C)n1 |
| InChI | InChI=1S/C24H32N4OS3/c1-15(2)31-20-14-17(5)25-23(32-16(3)4)22(20)28-21(29)12-8-9-13-30-24-26-18-10-6-7-11-19(18)27-24/h6-7,10-11,14-16H,8-9,12-13H2,1-5H3,(H,26,27)(H,28,29) |
| InChIKey | GSMJYAOLAYNYHS-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.75 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|