C27H27N3O3S — CID 21104898
N-[2-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]ethyl]-2-phenylacetamide (PubChem CID 21104898) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is N-[2-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]ethyl]-2-phenylacetamide.
| Compound Name | N-[2-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]ethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 21104898 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-[2-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]ethyl]-2-phenylacetamide |
| SMILES | COc1ccc(-c2nc(SCCNC(=O)Cc3ccccc3)[nH]c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H27N3O3S/c1-32-22-12-8-20(9-13-22)25-26(21-10-14-23(33-2)15-11-21)30-27(29-25)34-17-16-28-24(31)18-19-6-4-3-5-7-19/h3-15H,16-18H2,1-2H3,(H,28,31)(H,29,30) |
| InChIKey | LVLQWPLRCBEQKK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|