C24H20ClN3OS — CID 69444262
N-[2-[[5-(4-chlorophenyl)-4-phenyl-1H-imidazol-2-yl]sulfanyl]ethyl]benzamide (PubChem CID 69444262) has the molecular formula C24H20ClN3OS and a molecular weight of 433.96 g/mol. Its IUPAC name is N-[2-[[5-(4-chlorophenyl)-4-phenyl-1H-imidazol-2-yl]sulfanyl]ethyl]benzamide.
| Compound Name | N-[2-[[5-(4-chlorophenyl)-4-phenyl-1H-imidazol-2-yl]sulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 69444262 |
| Molecular Formula | C24H20ClN3OS |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | N-[2-[[5-(4-chlorophenyl)-4-phenyl-1H-imidazol-2-yl]sulfanyl]ethyl]benzamide |
| SMILES | O=C(NCCSc1nc(-c2ccccc2)c(-c2ccc(Cl)cc2)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C24H20ClN3OS/c25-20-13-11-18(12-14-20)22-21(17-7-3-1-4-8-17)27-24(28-22)30-16-15-26-23(29)19-9-5-2-6-10-19/h1-14H,15-16H2,(H,26,29)(H,27,28) |
| InChIKey | AFNQKWQIKUVKEF-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|