C26H23Cl2N3O3S — CID 69443523
N-[2-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]ethyl]-2,4-dichlorobenzamide (PubChem CID 69443523) has the molecular formula C26H23Cl2N3O3S and a molecular weight of 528.46 g/mol. Its IUPAC name is N-[2-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]ethyl]-2,4-dichlorobenzamide.
| Compound Name | N-[2-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]ethyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 69443523 |
| Molecular Formula | C26H23Cl2N3O3S |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | N-[2-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]ethyl]-2,4-dichlorobenzamide |
| SMILES | COc1ccc(-c2nc(SCCNC(=O)c3ccc(Cl)cc3Cl)[nH]c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H23Cl2N3O3S/c1-33-19-8-3-16(4-9-19)23-24(17-5-10-20(34-2)11-6-17)31-26(30-23)35-14-13-29-25(32)21-12-7-18(27)15-22(21)28/h3-12,15H,13-14H2,1-2H3,(H,29,32)(H,30,31) |
| InChIKey | ULTVUHVXTYZRSX-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|