C31H35N3O3S — CID 42725781
N-[3-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]-4-butylbenzamide (PubChem CID 42725781) has the molecular formula C31H35N3O3S and a molecular weight of 529.71 g/mol. Its IUPAC name is N-[3-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]-4-butylbenzamide.
| Compound Name | N-[3-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]-4-butylbenzamide |
|---|---|
| PubChem CID | 42725781 |
| Molecular Formula | C31H35N3O3S |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | N-[3-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]-4-butylbenzamide |
| SMILES | CCCCc1ccc(C(=O)NCCCSc2nc(-c3ccc(OC)cc3)c(-c3ccc(OC)cc3)[nH]2)cc1 |
| InChI | InChI=1S/C31H35N3O3S/c1-4-5-7-22-8-10-25(11-9-22)30(35)32-20-6-21-38-31-33-28(23-12-16-26(36-2)17-13-23)29(34-31)24-14-18-27(37-3)19-15-24/h8-19H,4-7,20-21H2,1-3H3,(H,32,35)(H,33,34) |
| InChIKey | GRINICPLHPOFOT-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|