C26H24FN3O3S — CID 5013327
N-[2-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]ethyl]-4-fluorobenzamide (PubChem CID 5013327) has the molecular formula C26H24FN3O3S and a molecular weight of 477.56 g/mol. Its IUPAC name is N-[2-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]ethyl]-4-fluorobenzamide.
| Compound Name | N-[2-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 5013327 |
| Molecular Formula | C26H24FN3O3S |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | N-[2-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]ethyl]-4-fluorobenzamide |
| SMILES | COc1ccc(-c2nc(SCCNC(=O)c3ccc(F)cc3)[nH]c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H24FN3O3S/c1-32-21-11-5-17(6-12-21)23-24(18-7-13-22(33-2)14-8-18)30-26(29-23)34-16-15-28-25(31)19-3-9-20(27)10-4-19/h3-14H,15-16H2,1-2H3,(H,28,31)(H,29,30) |
| InChIKey | KUSIWHHLLGTNKP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|