C20H23N3O4S2 — CID 69440081
3-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]propane-1-sulfonamide (PubChem CID 69440081) has the molecular formula C20H23N3O4S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 3-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]propane-1-sulfonamide.
| Compound Name | 3-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 69440081 |
| Molecular Formula | C20H23N3O4S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 3-[[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]sulfanyl]propane-1-sulfonamide |
| SMILES | COc1ccc(-c2nc(SCCCS(N)(=O)=O)[nH]c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H23N3O4S2/c1-26-16-8-4-14(5-9-16)18-19(15-6-10-17(27-2)11-7-15)23-20(22-18)28-12-3-13-29(21,24)25/h4-11H,3,12-13H2,1-2H3,(H,22,23)(H2,21,24,25) |
| InChIKey | WAWVCQDQODZAMI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|