C24H22N2O2S — CID 2718104
2-[2-(4-methoxyphenoxy)ethylsulfanyl]-4,5-diphenyl-1H-imidazole (PubChem CID 2718104) has the molecular formula C24H22N2O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenoxy)ethylsulfanyl]-4,5-diphenyl-1H-imidazole.
| Compound Name | 2-[2-(4-methoxyphenoxy)ethylsulfanyl]-4,5-diphenyl-1H-imidazole |
|---|---|
| PubChem CID | 2718104 |
| Molecular Formula | C24H22N2O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-[2-(4-methoxyphenoxy)ethylsulfanyl]-4,5-diphenyl-1H-imidazole |
| SMILES | COc1ccc(OCCSc2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C24H22N2O2S/c1-27-20-12-14-21(15-13-20)28-16-17-29-24-25-22(18-8-4-2-5-9-18)23(26-24)19-10-6-3-7-11-19/h2-15H,16-17H2,1H3,(H,25,26) |
| InChIKey | OWNAKGOUMUXCLF-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|